C12H14N2O3 — CID 125457648
2-ethyl-6,7-dimethoxyphthalazin-1-one (PubChem CID 125457648) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-ethyl-6,7-dimethoxyphthalazin-1-one.
| Compound Name | 2-ethyl-6,7-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 125457648 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-ethyl-6,7-dimethoxyphthalazin-1-one |
| SMILES | CCn1ncc2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C12H14N2O3/c1-4-14-12(15)9-6-11(17-3)10(16-2)5-8(9)7-13-14/h5-7H,4H2,1-3H3 |
| InChIKey | SNTQXDZVVAQVJV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |