C16H19N3O3 — CID 4912346
3,5-diethyl-7,9-dimethoxypyridazino[4,5-b]indol-4-one (PubChem CID 4912346) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is 3,5-diethyl-7,9-dimethoxypyridazino[4,5-b]indol-4-one.
| Compound Name | 3,5-diethyl-7,9-dimethoxypyridazino[4,5-b]indol-4-one |
|---|---|
| PubChem CID | 4912346 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 3,5-diethyl-7,9-dimethoxypyridazino[4,5-b]indol-4-one |
| SMILES | CCn1ncc2c3c(OC)cc(OC)cc3n(CC)c2c1=O |
| InChI | InChI=1S/C16H19N3O3/c1-5-18-12-7-10(21-3)8-13(22-4)14(12)11-9-17-19(6-2)16(20)15(11)18/h7-9H,5-6H2,1-4H3 |
| InChIKey | QNMKSSSLTSISQL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |