About 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one
3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one (PubChem CID 84638829) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one |
| PubChem CID | 84638829 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one |
| SMILES | COc1cc(OC)c2c(C)c(CN)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C14H18N2O3/c1-8-10(7-15)14(17)16(2)11-5-9(18-3)6-12(19-4)13(8)11/h5-6H,7,15H2,1-4H3 |
| InChIKey | ZXRYFYDRAICVMB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one?
The IUPAC name of 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one (CID 84638829) is 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one.
What is the SMILES notation for 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one?
The canonical SMILES for 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one is COc1cc(OC)c2c(C)c(CN)c(=O)n(C)c2c1.
What is the InChIKey of 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one?
The InChIKey is ZXRYFYDRAICVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-8-10(7-15)14(17)16(2)11-5-9(18-3)6-12(19-4)13(8)11/h5-6H,7,15H2,1-4H3.
What are the key properties of 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one?
3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one has a molecular weight of 262.31 g/mol, XLogP of 1.32, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-5,7-dimethoxy-1,4-dimethylquinolin-2-one is sourced from PubChem (CID 84638829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).