C28H28N2O6 — CID 141053736
5,12-diethyl-1,3,8,10-tetramethoxyquinolino[2,3-b]acridine-7,14-dione (PubChem CID 141053736) has the molecular formula C28H28N2O6 and a molecular weight of 488.54 g/mol. Its IUPAC name is 5,12-diethyl-1,3,8,10-tetramethoxyquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-diethyl-1,3,8,10-tetramethoxyquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 141053736 |
| Molecular Formula | C28H28N2O6 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 5,12-diethyl-1,3,8,10-tetramethoxyquinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCn1c2cc3c(=O)c4c(OC)cc(OC)cc4n(CC)c3cc2c(=O)c2c(OC)cc(OC)cc21 |
| InChI | InChI=1S/C28H28N2O6/c1-7-29-19-13-18-20(14-17(19)27(31)25-21(29)9-15(33-3)11-23(25)35-5)30(8-2)22-10-16(34-4)12-24(36-6)26(22)28(18)32/h9-14H,7-8H2,1-6H3 |
| InChIKey | JTRXGBSNZMDTPW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|