C40H36N2O4 — CID 58586577
5,12-bis[(4-methoxyphenyl)methyl]-1,4,8,11-tetramethylquinolino[2,3-b]acridine-7,14-dione (PubChem CID 58586577) has the molecular formula C40H36N2O4 and a molecular weight of 608.74 g/mol. Its IUPAC name is 5,12-bis[(4-methoxyphenyl)methyl]-1,4,8,11-tetramethylquinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-bis[(4-methoxyphenyl)methyl]-1,4,8,11-tetramethylquinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 58586577 |
| Molecular Formula | C40H36N2O4 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 5,12-bis[(4-methoxyphenyl)methyl]-1,4,8,11-tetramethylquinolino[2,3-b]acridine-7,14-dione |
| SMILES | COc1ccc(Cn2c3cc4c(=O)c5c(C)ccc(C)c5n(Cc5ccc(OC)cc5)c4cc3c(=O)c3c(C)ccc(C)c32)cc1 |
| InChI | InChI=1S/C40H36N2O4/c1-23-7-9-25(3)37-35(23)39(43)31-19-34-32(20-33(31)41(37)21-27-11-15-29(45-5)16-12-27)40(44)36-24(2)8-10-26(4)38(36)42(34)22-28-13-17-30(46-6)18-14-28/h7-20H,21-22H2,1-6H3 |
| InChIKey | GWDQQGMSRNQZKQ-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|