C20H19ClN2O4 — CID 57423840
6-chloro-1,3-bis[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione (PubChem CID 57423840) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 6-chloro-1,3-bis[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione.
| Compound Name | 6-chloro-1,3-bis[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57423840 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 6-chloro-1,3-bis[(4-methoxyphenyl)methyl]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cn2c(Cl)cc(=O)n(Cc3ccc(OC)cc3)c2=O)cc1 |
| InChI | InChI=1S/C20H19ClN2O4/c1-26-16-7-3-14(4-8-16)12-22-18(21)11-19(24)23(20(22)25)13-15-5-9-17(27-2)10-6-15/h3-11H,12-13H2,1-2H3 |
| InChIKey | ZVTRAHWHKCHEHN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |