C22H26N6O4 — CID 91084536
2-[2-[[3-[(4-hydroxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-2,6-dioxopyrimidin-4-yl]amino]ethyl]guanidine (PubChem CID 91084536) has the molecular formula C22H26N6O4 and a molecular weight of 438.49 g/mol. Its IUPAC name is 2-[2-[[3-[(4-hydroxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-2,6-dioxopyrimidin-4-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[3-[(4-hydroxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-2,6-dioxopyrimidin-4-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 91084536 |
| Molecular Formula | C22H26N6O4 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 2-[2-[[3-[(4-hydroxyphenyl)methyl]-1-[(4-methoxyphenyl)methyl]-2,6-dioxopyrimidin-4-yl]amino]ethyl]guanidine |
| SMILES | COc1ccc(Cn2c(=O)cc(NCCN=C(N)N)n(Cc3ccc(O)cc3)c2=O)cc1 |
| InChI | InChI=1S/C22H26N6O4/c1-32-18-8-4-16(5-9-18)14-28-20(30)12-19(25-10-11-26-21(23)24)27(22(28)31)13-15-2-6-17(29)7-3-15/h2-9,12,25,29H,10-11,13-14H2,1H3,(H4,23,24,26) |
| InChIKey | YXODIZWGIWZXJT-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 149.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|