C27H27Cl2N7O3 — CID 56595924
2-[2-[[5-[(3,4-dichlorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]-1-phenylguanidine (PubChem CID 56595924) has the molecular formula C27H27Cl2N7O3 and a molecular weight of 568.47 g/mol. Its IUPAC name is 2-[2-[[5-[(3,4-dichlorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]-1-phenylguanidine.
| Compound Name | 2-[2-[[5-[(3,4-dichlorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]-1-phenylguanidine |
|---|---|
| PubChem CID | 56595924 |
| Molecular Formula | C27H27Cl2N7O3 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | 2-[2-[[5-[(3,4-dichlorophenyl)methyl]-1-[(4-methoxyphenyl)methyl]-4,6-dioxo-1,3,5-triazin-2-yl]amino]ethyl]-1-phenylguanidine |
| SMILES | COc1ccc(Cn2c(NCC/N=C(\N)Nc3ccccc3)nc(=O)n(Cc3ccc(Cl)c(Cl)c3)c2=O)cc1 |
| InChI | InChI=1S/C27H27Cl2N7O3/c1-39-21-10-7-18(8-11-21)16-35-25(32-14-13-31-24(30)33-20-5-3-2-4-6-20)34-26(37)36(27(35)38)17-19-9-12-22(28)23(29)15-19/h2-12,15H,13-14,16-17H2,1H3,(H3,30,31,33)(H,32,34,37) |
| InChIKey | ZGUUVRJKMNTFSZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|