C23H27Cl2N7O2 — CID 11951201
2-[2-[[5-[(3,5-dichlorophenyl)methyl]-4,6-dioxo-1-[(4-propylphenyl)methyl]-1,3,5-triazin-2-yl]amino]ethyl]guanidine (PubChem CID 11951201) has the molecular formula C23H27Cl2N7O2 and a molecular weight of 504.42 g/mol. Its IUPAC name is 2-[2-[[5-[(3,5-dichlorophenyl)methyl]-4,6-dioxo-1-[(4-propylphenyl)methyl]-1,3,5-triazin-2-yl]amino]ethyl]guanidine.
| Compound Name | 2-[2-[[5-[(3,5-dichlorophenyl)methyl]-4,6-dioxo-1-[(4-propylphenyl)methyl]-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
|---|---|
| PubChem CID | 11951201 |
| Molecular Formula | C23H27Cl2N7O2 |
| Molecular Weight | 504.42 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-[2-[[5-[(3,5-dichlorophenyl)methyl]-4,6-dioxo-1-[(4-propylphenyl)methyl]-1,3,5-triazin-2-yl]amino]ethyl]guanidine |
| SMILES | CCCc1ccc(Cn2c(NCCN=C(N)N)nc(=O)n(Cc3cc(Cl)cc(Cl)c3)c2=O)cc1 |
| InChI | InChI=1S/C23H27Cl2N7O2/c1-2-3-15-4-6-16(7-5-15)13-31-21(29-9-8-28-20(26)27)30-22(33)32(23(31)34)14-17-10-18(24)12-19(25)11-17/h4-7,10-12H,2-3,8-9,13-14H2,1H3,(H4,26,27,28)(H,29,30,33) |
| InChIKey | FWFUASPTUVEWBJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|