C22H26N8O3 — CID 11950855
N-[4-[[3-benzyl-6-[2-(diaminomethylideneamino)ethylamino]-2,4-dioxo-1,3,5-triazin-1-yl]methyl]phenyl]acetamide (PubChem CID 11950855) has the molecular formula C22H26N8O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-[4-[[3-benzyl-6-[2-(diaminomethylideneamino)ethylamino]-2,4-dioxo-1,3,5-triazin-1-yl]methyl]phenyl]acetamide.
| Compound Name | N-[4-[[3-benzyl-6-[2-(diaminomethylideneamino)ethylamino]-2,4-dioxo-1,3,5-triazin-1-yl]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 11950855 |
| Molecular Formula | C22H26N8O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[4-[[3-benzyl-6-[2-(diaminomethylideneamino)ethylamino]-2,4-dioxo-1,3,5-triazin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Cn2c(NCCN=C(N)N)nc(=O)n(Cc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C22H26N8O3/c1-15(31)27-18-9-7-17(8-10-18)13-29-20(26-12-11-25-19(23)24)28-21(32)30(22(29)33)14-16-5-3-2-4-6-16/h2-10H,11-14H2,1H3,(H,27,31)(H4,23,24,25)(H,26,28,32) |
| InChIKey | VOBNMHQDUDTHQG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|