C16H22N6OS — CID 59004582
N-[4-[2-[4-[2-(diaminomethylideneamino)ethylamino]phenyl]ethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 59004582) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[4-[2-[4-[2-(diaminomethylideneamino)ethylamino]phenyl]ethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-[2-(diaminomethylideneamino)ethylamino]phenyl]ethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 59004582 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[4-[2-[4-[2-(diaminomethylideneamino)ethylamino]phenyl]ethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(NCCN=C(N)N)cc2)cs1 |
| InChI | InChI=1S/C16H22N6OS/c1-11(23)21-16-22-14(10-24-16)7-4-12-2-5-13(6-3-12)19-8-9-20-15(17)18/h2-3,5-6,10,19H,4,7-9H2,1H3,(H4,17,18,20)(H,21,22,23) |
| InChIKey | VTSCRFONVBXOSP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 118.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|