C27H41N5O5S — CID 87853692
[[3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]propylamino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid (PubChem CID 87853692) has the molecular formula C27H41N5O5S and a molecular weight of 547.72 g/mol. Its IUPAC name is [[3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]propylamino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid.
| Compound Name | [[3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]propylamino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 87853692 |
| Molecular Formula | C27H41N5O5S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | [[3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]propylamino]-[tert-butyl(carboxy)amino]methyl]-tert-butylcarbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2ccc(CCCNC(N(C(=O)O)C(C)(C)C)N(C(=O)O)C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C27H41N5O5S/c1-18(33)29-22-30-21(17-38-22)15-14-20-12-10-19(11-13-20)9-8-16-28-23(31(24(34)35)26(2,3)4)32(25(36)37)27(5,6)7/h10-13,17,23,28H,8-9,14-16H2,1-7H3,(H,34,35)(H,36,37)(H,29,30,33) |
| InChIKey | FKBHDAGGLFQNRI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|