C17H21N5O6S2 — CID 87182695
[3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]propylcarbamoylamino]-carboxycarbamic acid (PubChem CID 87182695) has the molecular formula C17H21N5O6S2 and a molecular weight of 455.52 g/mol. Its IUPAC name is [3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]propylcarbamoylamino]-carboxycarbamic acid.
| Compound Name | [3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]propylcarbamoylamino]-carboxycarbamic acid |
|---|---|
| PubChem CID | 87182695 |
| Molecular Formula | C17H21N5O6S2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.09 |
| IUPAC Name | [3-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]propylcarbamoylamino]-carboxycarbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2csc(CCCNC(=O)NN(C(=O)O)C(=O)O)c2)cs1 |
| InChI | InChI=1S/C17H21N5O6S2/c1-10(23)19-15-20-12(9-30-15)5-4-11-7-13(29-8-11)3-2-6-18-14(24)21-22(16(25)26)17(27)28/h7-9H,2-6H2,1H3,(H,25,26)(H,27,28)(H2,18,21,24)(H,19,20,23) |
| InChIKey | AFXVKEXLKCYGGH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|