C21H27N5O6S — CID 87182918
[[3-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]methylcarbamoylamino]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid (PubChem CID 87182918) has the molecular formula C21H27N5O6S and a molecular weight of 477.54 g/mol. Its IUPAC name is [[3-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]methylcarbamoylamino]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid.
| Compound Name | [[3-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]methylcarbamoylamino]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
|---|---|
| PubChem CID | 87182918 |
| Molecular Formula | C21H27N5O6S |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [[3-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]methylcarbamoylamino]-[(2-methylpropan-2-yl)oxycarbonyl]carbamic acid |
| SMILES | CC(=O)Nc1nc(CCc2cccc(CNC(=O)NN(C(=O)O)C(=O)OC(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C21H27N5O6S/c1-13(27)23-18-24-16(12-33-18)9-8-14-6-5-7-15(10-14)11-22-17(28)25-26(19(29)30)20(31)32-21(2,3)4/h5-7,10,12H,8-9,11H2,1-4H3,(H,29,30)(H2,22,25,28)(H,23,24,27) |
| InChIKey | USYZBEKEQIQLAM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 149.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|