C23H34N2OS — CID 173162018
N-[4-[2-[4-(2,2,3,4,4-pentamethylpentan-3-yl)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 173162018) has the molecular formula C23H34N2OS and a molecular weight of 386.61 g/mol. Its IUPAC name is N-[4-[2-[4-(2,2,3,4,4-pentamethylpentan-3-yl)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[2-[4-(2,2,3,4,4-pentamethylpentan-3-yl)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 173162018 |
| Molecular Formula | C23H34N2OS |
| Molecular Weight | 386.61 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N-[4-[2-[4-(2,2,3,4,4-pentamethylpentan-3-yl)phenyl]ethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(C(C)(C(C)(C)C)C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C23H34N2OS/c1-16(26)24-20-25-19(15-27-20)14-11-17-9-12-18(13-10-17)23(8,21(2,3)4)22(5,6)7/h9-10,12-13,15H,11,14H2,1-8H3,(H,24,25,26) |
| InChIKey | OTJKNCGORQZSJY-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |