C17H23IN4O2S2 — CID 87596945
O-methyl N-[2-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]ethyl]-N-aminocarbamothioate;hydroiodide (PubChem CID 87596945) has the molecular formula C17H23IN4O2S2 and a molecular weight of 506.44 g/mol. Its IUPAC name is O-methyl N-[2-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]ethyl]-N-aminocarbamothioate;hydroiodide.
| Compound Name | O-methyl N-[2-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]ethyl]-N-aminocarbamothioate;hydroiodide |
|---|---|
| PubChem CID | 87596945 |
| Molecular Formula | C17H23IN4O2S2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | O-methyl N-[2-[4-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]phenyl]ethyl]-N-aminocarbamothioate;hydroiodide |
| SMILES | COC(=S)N(N)CCc1ccc(CCc2csc(NC(C)=O)n2)cc1.I |
| InChI | InChI=1S/C17H22N4O2S2.HI/c1-12(22)19-16-20-15(11-25-16)8-7-13-3-5-14(6-4-13)9-10-21(18)17(24)23-2;/h3-6,11H,7-10,18H2,1-2H3,(H,19,20,22);1H |
| InChIKey | SZEBZWXGSBUTBL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|