C11H12N2OS2 — CID 154216694
N-[4-(2-thiophen-2-ylethyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 154216694) has the molecular formula C11H12N2OS2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[4-(2-thiophen-2-ylethyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-(2-thiophen-2-ylethyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 154216694 |
| Molecular Formula | C11H12N2OS2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | N-[4-(2-thiophen-2-ylethyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CCc2cccs2)cs1 |
| InChI | InChI=1S/C11H12N2OS2/c1-8(14)12-11-13-9(7-16-11)4-5-10-3-2-6-15-10/h2-3,6-7H,4-5H2,1H3,(H,12,13,14) |
| InChIKey | OCBFSCKGBCQVAW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |