C15H19N5O2S2 — CID 143197678
3-[5-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]-N-(diaminomethylidene)propanamide (PubChem CID 143197678) has the molecular formula C15H19N5O2S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[5-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]-N-(diaminomethylidene)propanamide.
| Compound Name | 3-[5-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]-N-(diaminomethylidene)propanamide |
|---|---|
| PubChem CID | 143197678 |
| Molecular Formula | C15H19N5O2S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 3-[5-[2-(2-acetamido-1,3-thiazol-4-yl)ethyl]thiophen-2-yl]-N-(diaminomethylidene)propanamide |
| SMILES | CC(=O)Nc1nc(CCc2ccc(CCC(=O)N=C(N)N)s2)cs1 |
| InChI | InChI=1S/C15H19N5O2S2/c1-9(21)18-15-19-10(8-23-15)2-3-11-4-5-12(24-11)6-7-13(22)20-14(16)17/h4-5,8H,2-3,6-7H2,1H3,(H,18,19,21)(H4,16,17,20,22) |
| InChIKey | GWANLPQRUBYZAK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|