C17H21N3O3S — CID 18322926
ethyl 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoate (PubChem CID 18322926) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is ethyl 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoate.
| Compound Name | ethyl 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoate |
|---|---|
| PubChem CID | 18322926 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl 4-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]butanoate |
| SMILES | CCOC(=O)CCCc1csc(NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-23-15(21)10-6-9-14-12-24-17(19-14)20-16(22)18-11-13-7-4-3-5-8-13/h3-5,7-8,12H,2,6,9-11H2,1H3,(H2,18,19,20,22) |
| InChIKey | VZNBHLPEGALHOD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |