C25H29FN4O3S — CID 87804784
N-[5-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]-2-[(4-fluorophenyl)methoxy]acetamide (PubChem CID 87804784) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is N-[5-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]-2-[(4-fluorophenyl)methoxy]acetamide.
| Compound Name | N-[5-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
|---|---|
| PubChem CID | 87804784 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | N-[5-[2-(benzylcarbamoylamino)-1,3-thiazol-4-yl]pentyl]-2-[(4-fluorophenyl)methoxy]acetamide |
| SMILES | O=C(COCc1ccc(F)cc1)NCCCCCc1csc(NC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C25H29FN4O3S/c26-21-12-10-20(11-13-21)16-33-17-23(31)27-14-6-2-5-9-22-18-34-25(29-22)30-24(32)28-15-19-7-3-1-4-8-19/h1,3-4,7-8,10-13,18H,2,5-6,9,14-17H2,(H,27,31)(H2,28,29,30,32) |
| InChIKey | KFLFEBXAYUXJQW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|