C14H17N3O2S — CID 87065383
1-(4-ethyl-1,3-thiazol-2-yl)-3-[(3-methoxyphenyl)methyl]urea (PubChem CID 87065383) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 1-(4-ethyl-1,3-thiazol-2-yl)-3-[(3-methoxyphenyl)methyl]urea.
| Compound Name | 1-(4-ethyl-1,3-thiazol-2-yl)-3-[(3-methoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 87065383 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 1-(4-ethyl-1,3-thiazol-2-yl)-3-[(3-methoxyphenyl)methyl]urea |
| SMILES | CCc1csc(NC(=O)NCc2cccc(OC)c2)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-3-11-9-20-14(16-11)17-13(18)15-8-10-5-4-6-12(7-10)19-2/h4-7,9H,3,8H2,1-2H3,(H2,15,16,17,18) |
| InChIKey | ISUKIKKCXNZTEK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |