C22H19N3O2S — CID 121081387
1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(naphthalen-1-ylmethyl)urea (PubChem CID 121081387) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is 1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(naphthalen-1-ylmethyl)urea.
| Compound Name | 1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(naphthalen-1-ylmethyl)urea |
|---|---|
| PubChem CID | 121081387 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-3-(naphthalen-1-ylmethyl)urea |
| SMILES | COc1cccc(-c2csc(NC(=O)NCc3cccc4ccccc34)n2)c1 |
| InChI | InChI=1S/C22H19N3O2S/c1-27-18-10-5-8-16(12-18)20-14-28-22(24-20)25-21(26)23-13-17-9-4-7-15-6-2-3-11-19(15)17/h2-12,14H,13H2,1H3,(H2,23,24,25,26) |
| InChIKey | MOXYFMRIWBFCTA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |