C15H16N2O4S — CID 80655489
4-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655489) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655489 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 4-[2-(phenylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C15H16N2O4S/c18-13(19)8-4-7-12-10-22-14(16-12)17-15(20)21-9-11-5-2-1-3-6-11/h1-3,5-6,10H,4,7-9H2,(H,18,19)(H,16,17,20) |
| InChIKey | BMPKGMLORAEDSN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |