C13H14N2O4S2 — CID 80655396
4-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]butanoic acid (PubChem CID 80655396) has the molecular formula C13H14N2O4S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]butanoic acid.
| Compound Name | 4-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]butanoic acid |
|---|---|
| PubChem CID | 80655396 |
| Molecular Formula | C13H14N2O4S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C13H14N2O4S2/c16-12(17)8-4-5-10-9-20-13(14-10)15-21(18,19)11-6-2-1-3-7-11/h1-3,6-7,9H,4-5,8H2,(H,14,15)(H,16,17) |
| InChIKey | USFFZQBVYNOWRI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |