C22H31N3O5S2 — CID 108789111
11-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]undecanoic acid (PubChem CID 108789111) has the molecular formula C22H31N3O5S2 and a molecular weight of 481.64 g/mol. Its IUPAC name is 11-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]undecanoic acid.
| Compound Name | 11-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]undecanoic acid |
|---|---|
| PubChem CID | 108789111 |
| Molecular Formula | C22H31N3O5S2 |
| Molecular Weight | 481.64 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 11-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]undecanoic acid |
| SMILES | O=C(O)CCCCCCCCCCNC(=O)Cc1csc(NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H31N3O5S2/c26-20(23-15-11-6-4-2-1-3-5-10-14-21(27)28)16-18-17-31-22(24-18)25-32(29,30)19-12-8-7-9-13-19/h7-9,12-13,17H,1-6,10-11,14-16H2,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | FTLAXIUMVJNPMY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|