C15H15N3O7S2 — CID 108789088
2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]butanedioic acid (PubChem CID 108789088) has the molecular formula C15H15N3O7S2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 108789088 |
| Molecular Formula | C15H15N3O7S2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[[2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]acetyl]amino]butanedioic acid |
| SMILES | O=C(O)CC(NC(=O)Cc1csc(NS(=O)(=O)c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C15H15N3O7S2/c19-12(17-11(14(22)23)7-13(20)21)6-9-8-26-15(16-9)18-27(24,25)10-4-2-1-3-5-10/h1-5,8,11H,6-7H2,(H,16,18)(H,17,19)(H,20,21)(H,22,23) |
| InChIKey | CBNBLNIAYKRCQY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 162.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |