C17H13Cl2N3O3S2 — CID 41231527
2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 41231527) has the molecular formula C17H13Cl2N3O3S2 and a molecular weight of 442.35 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 41231527 |
| Molecular Formula | C17H13Cl2N3O3S2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 440.98 |
| IUPAC Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1csc(NS(=O)(=O)c2ccccc2)n1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3O3S2/c18-14-7-6-11(8-15(14)19)20-16(23)9-12-10-26-17(21-12)22-27(24,25)13-4-2-1-3-5-13/h1-8,10H,9H2,(H,20,23)(H,21,22) |
| InChIKey | ORZKWFSXGQEPKQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |