C17H14N4O6S2 — CID 108802071
2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide (PubChem CID 108802071) has the molecular formula C17H14N4O6S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide.
| Compound Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 108802071 |
| Molecular Formula | C17H14N4O6S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 2-[2-(benzenesulfonamido)-1,3-thiazol-4-yl]-N-(2-hydroxy-4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1csc(NS(=O)(=O)c2ccccc2)n1)Nc1ccc([N+](=O)[O-])cc1O |
| InChI | InChI=1S/C17H14N4O6S2/c22-15-9-12(21(24)25)6-7-14(15)19-16(23)8-11-10-28-17(18-11)20-29(26,27)13-4-2-1-3-5-13/h1-7,9-10,22H,8H2,(H,18,20)(H,19,23) |
| InChIKey | YRQYHJUTEBWNGF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|