C10H7N3O6S2 — CID 121215679
2-[(4-nitrophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 121215679) has the molecular formula C10H7N3O6S2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 2-[(4-nitrophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(4-nitrophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 121215679 |
| Molecular Formula | C10H7N3O6S2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-[(4-nitrophenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C10H7N3O6S2/c14-9(15)8-5-20-10(11-8)12-21(18,19)7-3-1-6(2-4-7)13(16)17/h1-5H,(H,11,12)(H,14,15) |
| InChIKey | CJOLRRQKRDWIRZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 139.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|