C16H12N4O5S2 — CID 2246052
4-nitro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2246052) has the molecular formula C16H12N4O5S2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 4-nitro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-nitro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2246052 |
| Molecular Formula | C16H12N4O5S2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 4-nitro-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N4O5S2/c21-15(11-1-5-13(6-2-11)20(22)23)18-12-3-7-14(8-4-12)27(24,25)19-16-17-9-10-26-16/h1-10H,(H,17,19)(H,18,21) |
| InChIKey | GUTKGMSGEGCJLQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 131.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|