C17H16N4O3S2 — CID 87488160
N-(5,6-dimethyl-3-pyridinyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzamide (PubChem CID 87488160) has the molecular formula C17H16N4O3S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-(5,6-dimethyl-3-pyridinyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzamide.
| Compound Name | N-(5,6-dimethyl-3-pyridinyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 87488160 |
| Molecular Formula | C17H16N4O3S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | N-(5,6-dimethyl-3-pyridinyl)-4-(1,3-thiazol-2-ylsulfamoyl)benzamide |
| SMILES | Cc1cc(NC(=O)c2ccc(S(=O)(=O)Nc3nccs3)cc2)cnc1C |
| InChI | InChI=1S/C17H16N4O3S2/c1-11-9-14(10-19-12(11)2)20-16(22)13-3-5-15(6-4-13)26(23,24)21-17-18-7-8-25-17/h3-10H,1-2H3,(H,18,21)(H,20,22) |
| InChIKey | NOJHKNLOKZOMAE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |