C12H11N3O5S2 — CID 146122970
2-[[4-(1,3-thiazol-2-ylsulfamoyl)benzoyl]amino]acetic acid (PubChem CID 146122970) has the molecular formula C12H11N3O5S2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-[[4-(1,3-thiazol-2-ylsulfamoyl)benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 146122970 |
| Molecular Formula | C12H11N3O5S2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | 2-[[4-(1,3-thiazol-2-ylsulfamoyl)benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C12H11N3O5S2/c16-10(17)7-14-11(18)8-1-3-9(4-2-8)22(19,20)15-12-13-5-6-21-12/h1-6H,7H2,(H,13,15)(H,14,18)(H,16,17) |
| InChIKey | OYDMWLJVHVUDKC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |