C17H13ClN4O4S2 — CID 25041464
4-chloro-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzamide (PubChem CID 25041464) has the molecular formula C17H13ClN4O4S2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 4-chloro-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzamide.
| Compound Name | 4-chloro-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 25041464 |
| Molecular Formula | C17H13ClN4O4S2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 4-chloro-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamoyl]benzamide |
| SMILES | O=C(NC(=O)c1ccc(Cl)cc1)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C17H13ClN4O4S2/c18-12-3-1-11(2-4-12)15(23)21-16(24)20-13-5-7-14(8-6-13)28(25,26)22-17-19-9-10-27-17/h1-10H,(H,19,22)(H2,20,21,23,24) |
| InChIKey | CIEHCZNREIJNLL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |