C18H15BrN4O3S3 — CID 3376197
3-bromo-4-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 3376197) has the molecular formula C18H15BrN4O3S3 and a molecular weight of 511.45 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3376197 |
| Molecular Formula | C18H15BrN4O3S3 |
| Molecular Weight | 511.45 g/mol |
| Exact Mass | 509.95 |
| IUPAC Name | 3-bromo-4-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)cc1Br |
| InChI | InChI=1S/C18H15BrN4O3S3/c1-11-2-3-12(10-15(11)19)16(24)22-17(27)21-13-4-6-14(7-5-13)29(25,26)23-18-20-8-9-28-18/h2-10H,1H3,(H,20,23)(H2,21,22,24,27) |
| InChIKey | YOYMNBYPODCPHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|