C15H14N6O3S3 — CID 25048191
2-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]pyrazole-3-carboxamide (PubChem CID 25048191) has the molecular formula C15H14N6O3S3 and a molecular weight of 422.52 g/mol. Its IUPAC name is 2-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]pyrazole-3-carboxamide.
| Compound Name | 2-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 25048191 |
| Molecular Formula | C15H14N6O3S3 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-methyl-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]pyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C15H14N6O3S3/c1-21-12(6-7-17-21)13(22)19-14(25)18-10-2-4-11(5-3-10)27(23,24)20-15-16-8-9-26-15/h2-9H,1H3,(H,16,20)(H2,18,19,22,25) |
| InChIKey | KYMAUJUNIVQZST-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|