C18H16N4O4S3 — CID 6171535
(E)-3-(5-methylfuran-2-yl)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 6171535) has the molecular formula C18H16N4O4S3 and a molecular weight of 448.55 g/mol. Its IUPAC name is (E)-3-(5-methylfuran-2-yl)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(5-methylfuran-2-yl)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6171535 |
| Molecular Formula | C18H16N4O4S3 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (E)-3-(5-methylfuran-2-yl)-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nccs3)cc2)o1 |
| InChI | InChI=1S/C18H16N4O4S3/c1-12-2-5-14(26-12)6-9-16(23)21-17(27)20-13-3-7-15(8-4-13)29(24,25)22-18-19-10-11-28-18/h2-11H,1H3,(H,19,22)(H2,20,21,23,27)/b9-6+ |
| InChIKey | HTTCBUAXXYKROL-RMKNXTFCSA-N |
| XLogP | 3.37 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|