C15H15N5O3S2 — CID 19475273
2-ethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrazole-3-carboxamide (PubChem CID 19475273) has the molecular formula C15H15N5O3S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-ethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrazole-3-carboxamide.
| Compound Name | 2-ethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19475273 |
| Molecular Formula | C15H15N5O3S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 2-ethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]pyrazole-3-carboxamide |
| SMILES | CCn1nccc1C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C15H15N5O3S2/c1-2-20-13(7-8-17-20)14(21)18-11-3-5-12(6-4-11)25(22,23)19-15-16-9-10-24-15/h3-10H,2H2,1H3,(H,16,19)(H,18,21) |
| InChIKey | LKVIWVVICQNHLJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |