C15H19N3O3S2 — CID 17368902
3,3-dimethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 17368902) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3,3-dimethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | 3,3-dimethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 17368902 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3,3-dimethyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-15(2,3)10-13(19)17-11-4-6-12(7-5-11)23(20,21)18-14-16-8-9-22-14/h4-9H,10H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | FKDGOTRAIMTFRU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |