C16H23N3O4S2 — CID 90981855
ethane;4-hydroxy-2-methyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 90981855) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is ethane;4-hydroxy-2-methyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | ethane;4-hydroxy-2-methyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 90981855 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | ethane;4-hydroxy-2-methyl-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC.CC(CCO)C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C14H17N3O4S2.C2H6/c1-10(6-8-18)13(19)16-11-2-4-12(5-3-11)23(20,21)17-14-15-7-9-22-14;1-2/h2-5,7,9-10,18H,6,8H2,1H3,(H,15,17)(H,16,19);1-2H3 |
| InChIKey | FDSRSACWTMMGQQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |