C23H26N4O4S3 — CID 4942599
2-hexoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4942599) has the molecular formula C23H26N4O4S3 and a molecular weight of 518.69 g/mol. Its IUPAC name is 2-hexoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-hexoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4942599 |
| Molecular Formula | C23H26N4O4S3 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 2-hexoxy-N-[[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C23H26N4O4S3/c1-2-3-4-7-15-31-20-9-6-5-8-19(20)21(28)26-22(32)25-17-10-12-18(13-11-17)34(29,30)27-23-24-14-16-33-23/h5-6,8-14,16H,2-4,7,15H2,1H3,(H,24,27)(H2,25,26,28,32) |
| InChIKey | LFCZTKSYVWUACV-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|