C18H16N4O6S2 — CID 4951265
2-(4-nitrophenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]propanamide (PubChem CID 4951265) has the molecular formula C18H16N4O6S2 and a molecular weight of 448.48 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]propanamide.
| Compound Name | 2-(4-nitrophenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]propanamide |
|---|---|
| PubChem CID | 4951265 |
| Molecular Formula | C18H16N4O6S2 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-(4-nitrophenoxy)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]propanamide |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H16N4O6S2/c1-12(28-15-6-4-14(5-7-15)22(24)25)17(23)20-13-2-8-16(9-3-13)30(26,27)21-18-19-10-11-29-18/h2-12H,1H3,(H,19,21)(H,20,23) |
| InChIKey | QGVLRGSTEANMIQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|