C14H16N2O4S2 — CID 28858371
2-[(4-tert-butylphenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid (PubChem CID 28858371) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(4-tert-butylphenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 28858371 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-[(4-tert-butylphenyl)sulfonylamino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2nc(C(=O)O)cs2)cc1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-14(2,3)9-4-6-10(7-5-9)22(19,20)16-13-15-11(8-21-13)12(17)18/h4-8H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | JNPPXQHZVAXVDR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |