C10H10N2O3S2 — CID 43135540
4-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 43135540) has the molecular formula C10H10N2O3S2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43135540 |
| Molecular Formula | C10H10N2O3S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | 4-hydroxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C10H10N2O3S2/c1-7-6-16-10(11-7)12-17(14,15)9-4-2-8(13)3-5-9/h2-6,13H,1H3,(H,11,12) |
| InChIKey | OCQRROYZQBMFNY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |