C12H14N2O3S2 — CID 61481092
4-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 61481092) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61481092 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-hydroxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1csc(NS(=O)(=O)c2ccc(O)cc2)n1 |
| InChI | InChI=1S/C12H14N2O3S2/c1-8(2)11-7-18-12(13-11)14-19(16,17)10-5-3-9(15)4-6-10/h3-8,15H,1-2H3,(H,13,14) |
| InChIKey | LVNLQAZUWYNQLK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |