C13H17N3O3S2 — CID 61479503
3-amino-4-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 61479503) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-amino-4-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61479503 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-amino-4-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nc(C(C)C)cs2)cc1N |
| InChI | InChI=1S/C13H17N3O3S2/c1-8(2)11-7-20-13(15-11)16-21(17,18)9-4-5-12(19-3)10(14)6-9/h4-8H,14H2,1-3H3,(H,15,16) |
| InChIKey | LTQSEJCFDUNYOP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|