C10H10BrN3O2S2 — CID 115328636
3-amino-4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 115328636) has the molecular formula C10H10BrN3O2S2 and a molecular weight of 348.25 g/mol. Its IUPAC name is 3-amino-4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 3-amino-4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 115328636 |
| Molecular Formula | C10H10BrN3O2S2 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 3-amino-4-bromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc(Br)c(N)c2)n1 |
| InChI | InChI=1S/C10H10BrN3O2S2/c1-6-5-17-10(13-6)14-18(15,16)7-2-3-8(11)9(12)4-7/h2-5H,12H2,1H3,(H,13,14) |
| InChIKey | XGIGHVNFHGYPNB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|