About 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide
2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide (PubChem CID 63288690) has the molecular formula C11H10FN3O2S3
and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide.
Molecular Properties
| Compound Name | 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide |
| PubChem CID | 63288690 |
| Molecular Formula | C11H10FN3O2S3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc(F)c(C(N)=S)c2)n1 |
| InChI | InChI=1S/C11H10FN3O2S3/c1-6-5-19-11(14-6)15-20(16,17)7-2-3-9(12)8(4-7)10(13)18/h2-5H,1H3,(H2,13,18)(H,14,15) |
| InChIKey | NVEOKCOGMRNVEA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide?
The IUPAC name of 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide (CID 63288690) is 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide.
What is the SMILES notation for 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide?
The canonical SMILES for 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide is Cc1csc(NS(=O)(=O)c2ccc(F)c(C(N)=S)c2)n1.
What is the InChIKey of 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide?
The InChIKey is NVEOKCOGMRNVEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FN3O2S3/c1-6-5-19-11(14-6)15-20(16,17)7-2-3-9(12)8(4-7)10(13)18/h2-5H,1H3,(H2,13,18)(H,14,15).
What are the key properties of 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide?
2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide has a molecular weight of 331.42 g/mol, XLogP of 2.03, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzenecarbothioamide is sourced from PubChem (CID 63288690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).