C11H11N3O4S2 — CID 3820035
4-methyl-N-(4-methyl-1,3-thiazol-2-yl)-3-nitrobenzenesulfonamide (PubChem CID 3820035) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 4-methyl-N-(4-methyl-1,3-thiazol-2-yl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-methyl-N-(4-methyl-1,3-thiazol-2-yl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 3820035 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 4-methyl-N-(4-methyl-1,3-thiazol-2-yl)-3-nitrobenzenesulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C11H11N3O4S2/c1-7-3-4-9(5-10(7)14(15)16)20(17,18)13-11-12-8(2)6-19-11/h3-6H,1-2H3,(H,12,13) |
| InChIKey | SBLOXIQCWHJJRK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|