C9H10ClN5O4S — CID 163329284
4-methyl-3-nitro-N-(1,2,4-triazol-4-yl)benzenesulfonamide;hydrochloride (PubChem CID 163329284) has the molecular formula C9H10ClN5O4S and a molecular weight of 319.73 g/mol. Its IUPAC name is 4-methyl-3-nitro-N-(1,2,4-triazol-4-yl)benzenesulfonamide;hydrochloride.
| Compound Name | 4-methyl-3-nitro-N-(1,2,4-triazol-4-yl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 163329284 |
| Molecular Formula | C9H10ClN5O4S |
| Molecular Weight | 319.73 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 4-methyl-3-nitro-N-(1,2,4-triazol-4-yl)benzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)Nn2cnnc2)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C9H9N5O4S.ClH/c1-7-2-3-8(4-9(7)14(15)16)19(17,18)12-13-5-10-11-6-13;/h2-6,12H,1H3;1H |
| InChIKey | UUNRSWQSAQWFEN-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|