C11H16N2O7S — CID 107848426
N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-3-nitrobenzenesulfonamide (PubChem CID 107848426) has the molecular formula C11H16N2O7S and a molecular weight of 320.32 g/mol. Its IUPAC name is N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-3-nitrobenzenesulfonamide.
| Compound Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 107848426 |
| Molecular Formula | C11H16N2O7S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-4-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CO)(CO)CO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O7S/c1-8-2-3-9(4-10(8)13(17)18)21(19,20)12-11(5-14,6-15)7-16/h2-4,12,14-16H,5-7H2,1H3 |
| InChIKey | YHFCMXNGNLGGNL-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|